C23H41N4O9PS — CID 148561346
[(2R,4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 5-tert-butyl-2-methylpyrazolidine-3-carboxylate (PubChem CID 148561346) has the molecular formula C23H41N4O9PS and a molecular weight of 580.64 g/mol. Its IUPAC name is [(2R,4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 5-tert-butyl-2-methylpyrazolidine-3-carboxylate.
| Compound Name | [(2R,4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 5-tert-butyl-2-methylpyrazolidine-3-carboxylate |
|---|---|
| PubChem CID | 148561346 |
| Molecular Formula | C23H41N4O9PS |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | [(2R,4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 5-tert-butyl-2-methylpyrazolidine-3-carboxylate |
| SMILES | CC(=O)SCCNC(=O)CCNC(=O)[C@@H]1O[P@](=O)(OCOC(=O)C2CC(C(C)(C)C)NN2C)OCC1(C)C |
| InChI | InChI=1S/C23H41N4O9PS/c1-15(28)38-11-10-24-18(29)8-9-25-20(30)19-23(5,6)13-34-37(32,36-19)35-14-33-21(31)16-12-17(22(2,3)4)26-27(16)7/h16-17,19,26H,8-14H2,1-7H3,(H,24,29)(H,25,30)/t16?,17?,19-,37-/m0/s1 |
| InChIKey | SKWNYZQASXJXBU-SLCXWCQJSA-N |
| XLogP | 1.58 |
| TPSA | 161.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|