C21H34NO11PS — CID 146866821
2-[[(4R)-4-(8-acetylsulfanyl-5-oxooctanoyl)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethoxycarbonylamino]ethyl acetate (PubChem CID 146866821) has the molecular formula C21H34NO11PS and a molecular weight of 539.54 g/mol. Its IUPAC name is 2-[[(4R)-4-(8-acetylsulfanyl-5-oxooctanoyl)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethoxycarbonylamino]ethyl acetate.
| Compound Name | 2-[[(4R)-4-(8-acetylsulfanyl-5-oxooctanoyl)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethoxycarbonylamino]ethyl acetate |
|---|---|
| PubChem CID | 146866821 |
| Molecular Formula | C21H34NO11PS |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 2-[[(4R)-4-(8-acetylsulfanyl-5-oxooctanoyl)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethoxycarbonylamino]ethyl acetate |
| SMILES | CC(=O)OCCNC(=O)OCOP1(=O)OCC(C)(C)[C@H](C(=O)CCCC(=O)CCCSC(C)=O)O1 |
| InChI | InChI=1S/C21H34NO11PS/c1-15(23)29-11-10-22-20(27)30-14-32-34(28)31-13-21(3,4)19(33-34)18(26)9-5-7-17(25)8-6-12-35-16(2)24/h19H,5-14H2,1-4H3,(H,22,27)/t19-,34?/m0/s1 |
| InChIKey | SMHQHKNMBXJZIL-IZPSYREMSA-N |
| XLogP | 3.17 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|