C19H34N3O10PS — CID 139351186
methyl 3-[[(2S,4R)-2-[2-[(2S)-2-amino-3-methylbutanoyl]sulfanylethylcarbamoyloxymethoxy]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate (PubChem CID 139351186) has the molecular formula C19H34N3O10PS and a molecular weight of 527.53 g/mol. Its IUPAC name is methyl 3-[[(2S,4R)-2-[2-[(2S)-2-amino-3-methylbutanoyl]sulfanylethylcarbamoyloxymethoxy]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[(2S,4R)-2-[2-[(2S)-2-amino-3-methylbutanoyl]sulfanylethylcarbamoyloxymethoxy]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 139351186 |
| Molecular Formula | C19H34N3O10PS |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | methyl 3-[[(2S,4R)-2-[2-[(2S)-2-amino-3-methylbutanoyl]sulfanylethylcarbamoyloxymethoxy]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)[C@@H]1O[P@@](=O)(OCOC(=O)NCCSC(=O)[C@@H](N)C(C)C)OCC1(C)C |
| InChI | InChI=1S/C19H34N3O10PS/c1-12(2)14(20)17(25)34-9-8-22-18(26)29-11-31-33(27)30-10-19(3,4)15(32-33)16(24)21-7-6-13(23)28-5/h12,14-15H,6-11,20H2,1-5H3,(H,21,24)(H,22,26)/t14-,15-,33+/m0/s1 |
| InChIKey | QYHGSJYUPCGAEA-NNIFMKTOSA-N |
| XLogP | 1.16 |
| TPSA | 181.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|