C16H27N2O10PS — CID 137360572
methyl 3-[[(4R)-2-(2-acetylsulfanylethylcarbamoyloxymethoxy)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate (PubChem CID 137360572) has the molecular formula C16H27N2O10PS and a molecular weight of 470.44 g/mol. Its IUPAC name is methyl 3-[[(4R)-2-(2-acetylsulfanylethylcarbamoyloxymethoxy)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[(4R)-2-(2-acetylsulfanylethylcarbamoyloxymethoxy)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 137360572 |
| Molecular Formula | C16H27N2O10PS |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | methyl 3-[[(4R)-2-(2-acetylsulfanylethylcarbamoyloxymethoxy)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)[C@@H]1OP(=O)(OCOC(=O)NCCSC(C)=O)OCC1(C)C |
| InChI | InChI=1S/C16H27N2O10PS/c1-11(19)30-8-7-18-15(22)25-10-27-29(23)26-9-16(2,3)13(28-29)14(21)17-6-5-12(20)24-4/h13H,5-10H2,1-4H3,(H,17,21)(H,18,22)/t13-,29?/m0/s1 |
| InChIKey | BUHRQPCIYTUQRP-OOBPLEAZSA-N |
| XLogP | 1.20 |
| TPSA | 155.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|