C14H25N2O8P — CID 137360340
methyl 3-[[(4R)-2-(2-acetamidoethoxy)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate (PubChem CID 137360340) has the molecular formula C14H25N2O8P and a molecular weight of 380.33 g/mol. Its IUPAC name is methyl 3-[[(4R)-2-(2-acetamidoethoxy)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[(4R)-2-(2-acetamidoethoxy)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 137360340 |
| Molecular Formula | C14H25N2O8P |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | methyl 3-[[(4R)-2-(2-acetamidoethoxy)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)[C@@H]1OP(=O)(OCCNC(C)=O)OCC1(C)C |
| InChI | InChI=1S/C14H25N2O8P/c1-10(17)15-7-8-22-25(20)23-9-14(2,3)12(24-25)13(19)16-6-5-11(18)21-4/h12H,5-9H2,1-4H3,(H,15,17)(H,16,19)/t12-,25?/m0/s1 |
| InChIKey | SQUDGXZYRBNRQM-UNHBDAOFSA-N |
| XLogP | 0.37 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|