C16H22NO7P — CID 151362118
methyl 3-[[(4R)-5,5-dimethyl-2-oxo-2-phenoxy-1,3,2λ5-dioxaphosphinane-4-carbonyl](15N)amino](1,2,3-13C3)propanoate (PubChem CID 151362118) has the molecular formula C16H22NO7P and a molecular weight of 375.30 g/mol. Its IUPAC name is methyl 3-[[(4R)-5,5-dimethyl-2-oxo-2-phenoxy-1,3,2λ5-dioxaphosphinane-4-carbonyl](15N)amino](1,2,3-13C3)propanoate.
| Compound Name | methyl 3-[[(4R)-5,5-dimethyl-2-oxo-2-phenoxy-1,3,2λ5-dioxaphosphinane-4-carbonyl](15N)amino](1,2,3-13C3)propanoate |
|---|---|
| PubChem CID | 151362118 |
| Molecular Formula | C16H22NO7P |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | methyl 3-[[(4R)-5,5-dimethyl-2-oxo-2-phenoxy-1,3,2λ5-dioxaphosphinane-4-carbonyl](15N)amino](1,2,3-13C3)propanoate |
| SMILES | CO[13C](=O)[13CH2][13CH2][15NH]C(=O)[C@@H]1OP(=O)(Oc2ccccc2)OCC1(C)C |
| InChI | InChI=1S/C16H22NO7P/c1-16(2)11-22-25(20,23-12-7-5-4-6-8-12)24-14(16)15(19)17-10-9-13(18)21-3/h4-8,14H,9-11H2,1-3H3,(H,17,19)/t14-,25?/m0/s1/i9+1,10+1,13+1,17+1 |
| InChIKey | OORNEHXZLQFRSV-PXAXIWTLSA-N |
| XLogP | 2.29 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|