C17H23N2O7P — CID 137360577
methyl 3-[[(2S,4R)-2-(1-cyanocyclohexa-2,4-dien-1-yl)oxy-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate (PubChem CID 137360577) has the molecular formula C17H23N2O7P and a molecular weight of 398.35 g/mol. Its IUPAC name is methyl 3-[[(2S,4R)-2-(1-cyanocyclohexa-2,4-dien-1-yl)oxy-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[(2S,4R)-2-(1-cyanocyclohexa-2,4-dien-1-yl)oxy-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 137360577 |
| Molecular Formula | C17H23N2O7P |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | methyl 3-[[(2S,4R)-2-(1-cyanocyclohexa-2,4-dien-1-yl)oxy-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)[C@@H]1O[P@@](=O)(OC2(C#N)C=CC=CC2)OCC1(C)C |
| InChI | InChI=1S/C17H23N2O7P/c1-16(2)12-24-27(22,26-17(11-18)8-5-4-6-9-17)25-14(16)15(21)19-10-7-13(20)23-3/h4-6,8,14H,7,9-10,12H2,1-3H3,(H,19,21)/t14-,17?,27-/m0/s1 |
| InChIKey | XZGSJEUUDHZSMP-UUQYHGOWSA-N |
| XLogP | 2.01 |
| TPSA | 123.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|