C18H32NO11PS — CID 129218247
[(2S,4R)-5,5-dimethyl-4-[[3-(2-methylsulfonylethoxy)-3-oxopropyl]carbamoyl]-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 129218247) has the molecular formula C18H32NO11PS and a molecular weight of 501.49 g/mol. Its IUPAC name is [(2S,4R)-5,5-dimethyl-4-[[3-(2-methylsulfonylethoxy)-3-oxopropyl]carbamoyl]-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [(2S,4R)-5,5-dimethyl-4-[[3-(2-methylsulfonylethoxy)-3-oxopropyl]carbamoyl]-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 129218247 |
| Molecular Formula | C18H32NO11PS |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | [(2S,4R)-5,5-dimethyl-4-[[3-(2-methylsulfonylethoxy)-3-oxopropyl]carbamoyl]-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCO[P@@]1(=O)OCC(C)(C)[C@H](C(=O)NCCC(=O)OCCS(C)(=O)=O)O1 |
| InChI | InChI=1S/C18H32NO11PS/c1-17(2,3)16(22)27-12-29-31(23)28-11-18(4,5)14(30-31)15(21)19-8-7-13(20)26-9-10-32(6,24)25/h14H,7-12H2,1-6H3,(H,19,21)/t14-,31+/m0/s1 |
| InChIKey | KBTFCDGAMBVMGB-AOYOOGHLSA-N |
| XLogP | 1.19 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|