C19H34NO11P — CID 139351190
3-ethoxypropyl 3-[[(4R)-5,5-dimethyl-2-oxo-2-(propan-2-yloxycarbonyloxymethoxy)-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate (PubChem CID 139351190) has the molecular formula C19H34NO11P and a molecular weight of 483.45 g/mol. Its IUPAC name is 3-ethoxypropyl 3-[[(4R)-5,5-dimethyl-2-oxo-2-(propan-2-yloxycarbonyloxymethoxy)-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate.
| Compound Name | 3-ethoxypropyl 3-[[(4R)-5,5-dimethyl-2-oxo-2-(propan-2-yloxycarbonyloxymethoxy)-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 139351190 |
| Molecular Formula | C19H34NO11P |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 3-ethoxypropyl 3-[[(4R)-5,5-dimethyl-2-oxo-2-(propan-2-yloxycarbonyloxymethoxy)-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoate |
| SMILES | CCOCCCOC(=O)CCNC(=O)[C@@H]1OP(=O)(OCOC(=O)OC(C)C)OCC1(C)C |
| InChI | InChI=1S/C19H34NO11P/c1-6-25-10-7-11-26-15(21)8-9-20-17(22)16-19(4,5)12-28-32(24,31-16)29-13-27-18(23)30-14(2)3/h14,16H,6-13H2,1-5H3,(H,20,22)/t16-,32?/m0/s1 |
| InChIKey | OFMKBNHAYKLUPY-KXJSNILUSA-N |
| XLogP | 2.55 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|