C22H38N3O11PS — CID 134210564
2-[[(2R,4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethoxycarbonylamino]ethyl 2,2-dimethylpropanoate (PubChem CID 134210564) has the molecular formula C22H38N3O11PS and a molecular weight of 583.60 g/mol. Its IUPAC name is 2-[[(2R,4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethoxycarbonylamino]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[[(2R,4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethoxycarbonylamino]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134210564 |
| Molecular Formula | C22H38N3O11PS |
| Molecular Weight | 583.60 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | 2-[[(2R,4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethoxycarbonylamino]ethyl 2,2-dimethylpropanoate |
| SMILES | CC(=O)SCCNC(=O)CCNC(=O)[C@@H]1O[P@](=O)(OCOC(=O)NCCOC(=O)C(C)(C)C)OCC1(C)C |
| InChI | InChI=1S/C22H38N3O11PS/c1-15(26)38-12-10-23-16(27)7-8-24-18(28)17-22(5,6)13-34-37(31,36-17)35-14-33-20(30)25-9-11-32-19(29)21(2,3)4/h17H,7-14H2,1-6H3,(H,23,27)(H,24,28)(H,25,30)/t17-,37-/m0/s1 |
| InChIKey | HCVGILDJDHUHGC-ZUDGJFPWSA-N |
| XLogP | 1.73 |
| TPSA | 184.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.60 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|