C22H34F3N2O9PS — CID 153275924
[(4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 4-(trifluoromethyl)cyclohexane-1-carboxylate (PubChem CID 153275924) has the molecular formula C22H34F3N2O9PS and a molecular weight of 590.55 g/mol. Its IUPAC name is [(4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 4-(trifluoromethyl)cyclohexane-1-carboxylate.
| Compound Name | [(4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 4-(trifluoromethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 153275924 |
| Molecular Formula | C22H34F3N2O9PS |
| Molecular Weight | 590.55 g/mol |
| Exact Mass | 590.17 |
| IUPAC Name | [(4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 4-(trifluoromethyl)cyclohexane-1-carboxylate |
| SMILES | CC(=O)SCCNC(=O)CCNC(=O)[C@@H]1OP(=O)(OCOC(=O)C2CCC(C(F)(F)F)CC2)OCC1(C)C |
| InChI | InChI=1S/C22H34F3N2O9PS/c1-14(28)38-11-10-26-17(29)8-9-27-19(30)18-21(2,3)12-34-37(32,36-18)35-13-33-20(31)15-4-6-16(7-5-15)22(23,24)25/h15-16,18H,4-13H2,1-3H3,(H,26,29)(H,27,30)/t15?,16?,18-,37?/m0/s1 |
| InChIKey | LGPAMSIRESXFJN-GUZOISHQSA-N |
| XLogP | 3.32 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|