C22H35N4O9PS — CID 146225992
[(2R,4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 5-tert-butyl-1H-pyrazole-3-carboxylate (PubChem CID 146225992) has the molecular formula C22H35N4O9PS and a molecular weight of 562.58 g/mol. Its IUPAC name is [(2R,4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 5-tert-butyl-1H-pyrazole-3-carboxylate.
| Compound Name | [(2R,4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 5-tert-butyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 146225992 |
| Molecular Formula | C22H35N4O9PS |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | [(2R,4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 5-tert-butyl-1H-pyrazole-3-carboxylate |
| SMILES | CC(=O)SCCNC(=O)CCNC(=O)[C@@H]1O[P@](=O)(OCOC(=O)c2cc(C(C)(C)C)[nH]n2)OCC1(C)C |
| InChI | InChI=1S/C22H35N4O9PS/c1-14(27)37-10-9-23-17(28)7-8-24-19(29)18-22(5,6)12-33-36(31,35-18)34-13-32-20(30)15-11-16(26-25-15)21(2,3)4/h11,18H,7-10,12-13H2,1-6H3,(H,23,28)(H,24,29)(H,25,26)/t18-,36-/m0/s1 |
| InChIKey | MEAYPKRFEVLKDM-DVBGFMBJSA-N |
| XLogP | 2.29 |
| TPSA | 175.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|