C18H28N3O9P — CID 129226915
[(2S,4R)-4-[(3-methoxy-3-oxopropyl)carbamoyl]-5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 5-tert-butyl-1H-pyrazole-3-carboxylate (PubChem CID 129226915) has the molecular formula C18H28N3O9P and a molecular weight of 461.41 g/mol. Its IUPAC name is [(2S,4R)-4-[(3-methoxy-3-oxopropyl)carbamoyl]-5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 5-tert-butyl-1H-pyrazole-3-carboxylate.
| Compound Name | [(2S,4R)-4-[(3-methoxy-3-oxopropyl)carbamoyl]-5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 5-tert-butyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 129226915 |
| Molecular Formula | C18H28N3O9P |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | [(2S,4R)-4-[(3-methoxy-3-oxopropyl)carbamoyl]-5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 5-tert-butyl-1H-pyrazole-3-carboxylate |
| SMILES | COC(=O)CCNC(=O)[C@@H]1O[P@@](=O)(OCOC(=O)c2cc(C(C)(C)C)[nH]n2)OCC1C |
| InChI | InChI=1S/C18H28N3O9P/c1-11-9-28-31(25,30-15(11)16(23)19-7-6-14(22)26-5)29-10-27-17(24)12-8-13(21-20-12)18(2,3)4/h8,11,15H,6-7,9-10H2,1-5H3,(H,19,23)(H,20,21)/t11?,15-,31-/m1/s1 |
| InChIKey | OUMDIVJEHUBNRI-JDNOVUHQSA-N |
| XLogP | 1.68 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|