C14H24NO9P — CID 139351234
[(4R)-4-[(3-methoxy-3-oxopropyl)carbamoyl]-5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 2-methylpropanoate (PubChem CID 139351234) has the molecular formula C14H24NO9P and a molecular weight of 381.32 g/mol. Its IUPAC name is [(4R)-4-[(3-methoxy-3-oxopropyl)carbamoyl]-5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 2-methylpropanoate.
| Compound Name | [(4R)-4-[(3-methoxy-3-oxopropyl)carbamoyl]-5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 139351234 |
| Molecular Formula | C14H24NO9P |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | [(4R)-4-[(3-methoxy-3-oxopropyl)carbamoyl]-5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl 2-methylpropanoate |
| SMILES | COC(=O)CCNC(=O)[C@@H]1OP(=O)(OCOC(=O)C(C)C)OCC1C |
| InChI | InChI=1S/C14H24NO9P/c1-9(2)14(18)21-8-23-25(19)22-7-10(3)12(24-25)13(17)15-6-5-11(16)20-4/h9-10,12H,5-8H2,1-4H3,(H,15,17)/t10?,12-,25?/m1/s1 |
| InChIKey | CAOKRULLZJQTDM-ZXBZCBGQSA-N |
| XLogP | 1.00 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|