C24H41N2O10PS2 — CID 162278478
S-[2-[[(2R,4R)-4-(8-acetylsulfanyl-5-oxooctanoyl)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethoxycarbonylamino]ethyl] (2S)-2-amino-3-methylbutanethioate (PubChem CID 162278478) has the molecular formula C24H41N2O10PS2 and a molecular weight of 612.70 g/mol. Its IUPAC name is S-[2-[[(2R,4R)-4-(8-acetylsulfanyl-5-oxooctanoyl)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethoxycarbonylamino]ethyl] (2S)-2-amino-3-methylbutanethioate.
| Compound Name | S-[2-[[(2R,4R)-4-(8-acetylsulfanyl-5-oxooctanoyl)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethoxycarbonylamino]ethyl] (2S)-2-amino-3-methylbutanethioate |
|---|---|
| PubChem CID | 162278478 |
| Molecular Formula | C24H41N2O10PS2 |
| Molecular Weight | 612.70 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | S-[2-[[(2R,4R)-4-(8-acetylsulfanyl-5-oxooctanoyl)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethoxycarbonylamino]ethyl] (2S)-2-amino-3-methylbutanethioate |
| SMILES | CC(=O)SCCCC(=O)CCCC(=O)[C@@H]1O[P@](=O)(OCOC(=O)NCCSC(=O)[C@@H](N)C(C)C)OCC1(C)C |
| InChI | InChI=1S/C24H41N2O10PS2/c1-16(2)20(25)22(30)39-13-11-26-23(31)33-15-35-37(32)34-14-24(4,5)21(36-37)19(29)10-6-8-18(28)9-7-12-38-17(3)27/h16,20-21H,6-15,25H2,1-5H3,(H,26,31)/t20-,21-,37-/m0/s1 |
| InChIKey | FUXKLPSXQXOSPV-JNNZLFMQSA-N |
| XLogP | 3.85 |
| TPSA | 177.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.70 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|