C26H44N2O9S — CID 162512920
methyl 3-[5,5-dimethyl-2-[2-oxo-2-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoylamino]ethylsulfanyl]ethyl]-1,3-dioxan-2-yl]propanoate (PubChem CID 162512920) has the molecular formula C26H44N2O9S and a molecular weight of 560.71 g/mol. Its IUPAC name is methyl 3-[5,5-dimethyl-2-[2-oxo-2-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoylamino]ethylsulfanyl]ethyl]-1,3-dioxan-2-yl]propanoate.
| Compound Name | methyl 3-[5,5-dimethyl-2-[2-oxo-2-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoylamino]ethylsulfanyl]ethyl]-1,3-dioxan-2-yl]propanoate |
|---|---|
| PubChem CID | 162512920 |
| Molecular Formula | C26H44N2O9S |
| Molecular Weight | 560.71 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | methyl 3-[5,5-dimethyl-2-[2-oxo-2-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoylamino]ethylsulfanyl]ethyl]-1,3-dioxan-2-yl]propanoate |
| SMILES | COC(=O)CCC1(CC(=O)SCCNC(=O)CCNC(=O)[C@@H]2OC(C)(C)OCC2(C)C)OCC(C)(C)CO1 |
| InChI | InChI=1S/C26H44N2O9S/c1-23(2)15-35-26(36-16-23,10-8-19(30)33-7)14-20(31)38-13-12-27-18(29)9-11-28-22(32)21-24(3,4)17-34-25(5,6)37-21/h21H,8-17H2,1-7H3,(H,27,29)(H,28,32)/t21-/m0/s1 |
| InChIKey | GWXGZDHSOVFQOL-NRFANRHFSA-N |
| XLogP | 2.16 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.71 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|