C25H35N5O5 — CID 151499099
(4R)-2,2,5,5-tetramethyl-N-[(E)-3-oxo-3-[[3-oxo-3-[(6-propyl-1H-benzimidazol-2-yl)amino]propyl]amino]prop-1-enyl]-1,3-dioxane-4-carboxamide (PubChem CID 151499099) has the molecular formula C25H35N5O5 and a molecular weight of 485.59 g/mol. Its IUPAC name is (4R)-2,2,5,5-tetramethyl-N-[(E)-3-oxo-3-[[3-oxo-3-[(6-propyl-1H-benzimidazol-2-yl)amino]propyl]amino]prop-1-enyl]-1,3-dioxane-4-carboxamide.
| Compound Name | (4R)-2,2,5,5-tetramethyl-N-[(E)-3-oxo-3-[[3-oxo-3-[(6-propyl-1H-benzimidazol-2-yl)amino]propyl]amino]prop-1-enyl]-1,3-dioxane-4-carboxamide |
|---|---|
| PubChem CID | 151499099 |
| Molecular Formula | C25H35N5O5 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | (4R)-2,2,5,5-tetramethyl-N-[(E)-3-oxo-3-[[3-oxo-3-[(6-propyl-1H-benzimidazol-2-yl)amino]propyl]amino]prop-1-enyl]-1,3-dioxane-4-carboxamide |
| SMILES | CCCc1ccc2nc(NC(=O)CCNC(=O)/C=C/NC(=O)[C@@H]3OC(C)(C)OCC3(C)C)[nH]c2c1 |
| InChI | InChI=1S/C25H35N5O5/c1-6-7-16-8-9-17-18(14-16)29-23(28-17)30-20(32)11-12-26-19(31)10-13-27-22(33)21-24(2,3)15-34-25(4,5)35-21/h8-10,13-14,21H,6-7,11-12,15H2,1-5H3,(H,26,31)(H,27,33)(H2,28,29,30,32)/b13-10+/t21-/m0/s1 |
| InChIKey | PQAOJFJGPCCBIE-BGVYSJOJSA-N |
| XLogP | 2.77 |
| TPSA | 134.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|