C15H23N — CID 23142752
2-(3,3,4,4-tetramethylcyclopentyl)aniline (PubChem CID 23142752) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 2-(3,3,4,4-tetramethylcyclopentyl)aniline.
| Compound Name | 2-(3,3,4,4-tetramethylcyclopentyl)aniline |
|---|---|
| PubChem CID | 23142752 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 2-(3,3,4,4-tetramethylcyclopentyl)aniline |
| SMILES | CC1(C)CC(c2ccccc2N)CC1(C)C |
| InChI | InChI=1S/C15H23N/c1-14(2)9-11(10-15(14,3)4)12-7-5-6-8-13(12)16/h5-8,11H,9-10,16H2,1-4H3 |
| InChIKey | ZJNXCLNDXLYULS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|