C14H18ClNO5S — CID 134279623
(8-chlorospiro[4H-1,3-benzodioxine-2,1'-cyclohexane]-4-yl)methylsulfamic acid (PubChem CID 134279623) has the molecular formula C14H18ClNO5S and a molecular weight of 347.82 g/mol. Its IUPAC name is (8-chlorospiro[4H-1,3-benzodioxine-2,1'-cyclohexane]-4-yl)methylsulfamic acid.
| Compound Name | (8-chlorospiro[4H-1,3-benzodioxine-2,1'-cyclohexane]-4-yl)methylsulfamic acid |
|---|---|
| PubChem CID | 134279623 |
| Molecular Formula | C14H18ClNO5S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | (8-chlorospiro[4H-1,3-benzodioxine-2,1'-cyclohexane]-4-yl)methylsulfamic acid |
| SMILES | O=S(=O)(O)NCC1OC2(CCCCC2)Oc2c(Cl)cccc21 |
| InChI | InChI=1S/C14H18ClNO5S/c15-11-6-4-5-10-12(9-16-22(17,18)19)20-14(21-13(10)11)7-2-1-3-8-14/h4-6,12,16H,1-3,7-9H2,(H,17,18,19) |
| InChIKey | DDFBMGMNCQQAGL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|