C12H15ClO3 — CID 118142415
2-(8-chloro-2,2-dimethyl-4H-1,3-benzodioxin-4-yl)ethanol (PubChem CID 118142415) has the molecular formula C12H15ClO3 and a molecular weight of 242.70 g/mol. Its IUPAC name is 2-(8-chloro-2,2-dimethyl-4H-1,3-benzodioxin-4-yl)ethanol.
| Compound Name | 2-(8-chloro-2,2-dimethyl-4H-1,3-benzodioxin-4-yl)ethanol |
|---|---|
| PubChem CID | 118142415 |
| Molecular Formula | C12H15ClO3 |
| Molecular Weight | 242.70 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-(8-chloro-2,2-dimethyl-4H-1,3-benzodioxin-4-yl)ethanol |
| SMILES | CC1(C)Oc2c(Cl)cccc2C(CCO)O1 |
| InChI | InChI=1S/C12H15ClO3/c1-12(2)15-10(6-7-14)8-4-3-5-9(13)11(8)16-12/h3-5,10,14H,6-7H2,1-2H3 |
| InChIKey | MXOLGRVNHFNYRV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.70 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |