C18H25BrO2 — CID 10570043
4-[(E)-4-bromo-3-methylbut-2-enyl]-2,2-dimethyl-8-propan-2-yl-4H-1,3-benzodioxine (PubChem CID 10570043) has the molecular formula C18H25BrO2 and a molecular weight of 353.30 g/mol. Its IUPAC name is 4-[(E)-4-bromo-3-methylbut-2-enyl]-2,2-dimethyl-8-propan-2-yl-4H-1,3-benzodioxine.
| Compound Name | 4-[(E)-4-bromo-3-methylbut-2-enyl]-2,2-dimethyl-8-propan-2-yl-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 10570043 |
| Molecular Formula | C18H25BrO2 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 4-[(E)-4-bromo-3-methylbut-2-enyl]-2,2-dimethyl-8-propan-2-yl-4H-1,3-benzodioxine |
| SMILES | C/C(=C\CC1OC(C)(C)Oc2c(C(C)C)cccc21)CBr |
| InChI | InChI=1S/C18H25BrO2/c1-12(2)14-7-6-8-15-16(10-9-13(3)11-19)20-18(4,5)21-17(14)15/h6-9,12,16H,10-11H2,1-5H3/b13-9+ |
| InChIKey | LSMMTBRUMQAPHC-UKTHLTGXSA-N |
| XLogP | 5.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|