C13H19NO2 — CID 75366060
4-amino-9-propan-2-yl-2,3,4,5-tetrahydro-1-benzoxepin-5-ol (PubChem CID 75366060) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 4-amino-9-propan-2-yl-2,3,4,5-tetrahydro-1-benzoxepin-5-ol.
| Compound Name | 4-amino-9-propan-2-yl-2,3,4,5-tetrahydro-1-benzoxepin-5-ol |
|---|---|
| PubChem CID | 75366060 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 4-amino-9-propan-2-yl-2,3,4,5-tetrahydro-1-benzoxepin-5-ol |
| SMILES | CC(C)c1cccc2c1OCCC(N)C2O |
| InChI | InChI=1S/C13H19NO2/c1-8(2)9-4-3-5-10-12(15)11(14)6-7-16-13(9)10/h3-5,8,11-12,15H,6-7,14H2,1-2H3 |
| InChIKey | HWSLSDIQOFADNF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |