C11H15NO2 — CID 75464999
4-amino-9-methyl-2,3,4,5-tetrahydro-1-benzoxepin-5-ol (PubChem CID 75464999) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-amino-9-methyl-2,3,4,5-tetrahydro-1-benzoxepin-5-ol.
| Compound Name | 4-amino-9-methyl-2,3,4,5-tetrahydro-1-benzoxepin-5-ol |
|---|---|
| PubChem CID | 75464999 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 4-amino-9-methyl-2,3,4,5-tetrahydro-1-benzoxepin-5-ol |
| SMILES | Cc1cccc2c1OCCC(N)C2O |
| InChI | InChI=1S/C11H15NO2/c1-7-3-2-4-8-10(13)9(12)5-6-14-11(7)8/h2-4,9-10,13H,5-6,12H2,1H3 |
| InChIKey | PZZRUNVYIPAFAM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |