About ethane;1-[(2E)-4-methylpenta-2,4-dien-2-yl]-2-propan-2-ylbenzene
ethane;1-[(2E)-4-methylpenta-2,4-dien-2-yl]-2-propan-2-ylbenzene (PubChem CID 142104911) has the molecular formula C21H38
and a molecular weight of 290.54 g/mol. Its IUPAC name is ethane;1-[(2E)-4-methylpenta-2,4-dien-2-yl]-2-propan-2-ylbenzene.
Molecular Properties
| Compound Name | ethane;1-[(2E)-4-methylpenta-2,4-dien-2-yl]-2-propan-2-ylbenzene |
| PubChem CID | 142104911 |
| Molecular Formula | C21H38 |
| Molecular Weight | 290.54 g/mol |
| Exact Mass | 290.30 |
| IUPAC Name | ethane;1-[(2E)-4-methylpenta-2,4-dien-2-yl]-2-propan-2-ylbenzene |
| SMILES | C=C(C)/C=C(\C)c1ccccc1C(C)C.CC.CC.CC |
| InChI | InChI=1S/C15H20.3C2H6/c1-11(2)10-13(5)15-9-7-6-8-14(15)12(3)4;3*1-2/h6-10,12H,1H2,2-5H3;3*1-2H3/b13-10+;;; |
| InChIKey | BWDNAHHHHQHODL-SAOBJNJYSA-N |
| XLogP | 7.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.54 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[(2E)-4-methylpenta-2,4-dien-2-yl]-2-propan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[(2E)-4-methylpenta-2,4-dien-2-yl]-2-propan-2-ylbenzene?
The IUPAC name of ethane;1-[(2E)-4-methylpenta-2,4-dien-2-yl]-2-propan-2-ylbenzene (CID 142104911) is ethane;1-[(2E)-4-methylpenta-2,4-dien-2-yl]-2-propan-2-ylbenzene.
What is the SMILES notation for ethane;1-[(2E)-4-methylpenta-2,4-dien-2-yl]-2-propan-2-ylbenzene?
The canonical SMILES for ethane;1-[(2E)-4-methylpenta-2,4-dien-2-yl]-2-propan-2-ylbenzene is C=C(C)/C=C(\C)c1ccccc1C(C)C.CC.CC.CC.
What is the InChIKey of ethane;1-[(2E)-4-methylpenta-2,4-dien-2-yl]-2-propan-2-ylbenzene?
The InChIKey is BWDNAHHHHQHODL-SAOBJNJYSA-N. The full InChI is InChI=1S/C15H20.3C2H6/c1-11(2)10-13(5)15-9-7-6-8-14(15)12(3)4;3*1-2/h6-10,12H,1H2,2-5H3;3*1-2H3/b13-10+;;;.
What are the key properties of ethane;1-[(2E)-4-methylpenta-2,4-dien-2-yl]-2-propan-2-ylbenzene?
ethane;1-[(2E)-4-methylpenta-2,4-dien-2-yl]-2-propan-2-ylbenzene has a molecular weight of 290.54 g/mol, XLogP of 7.87, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[(2E)-4-methylpenta-2,4-dien-2-yl]-2-propan-2-ylbenzene is sourced from PubChem (CID 142104911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).