C12H13Cl — CID 143764224
1-chloro-3-[(2E)-4-methylpenta-2,4-dien-2-yl]benzene (PubChem CID 143764224) has the molecular formula C12H13Cl and a molecular weight of 192.69 g/mol. Its IUPAC name is 1-chloro-3-[(2E)-4-methylpenta-2,4-dien-2-yl]benzene.
| Compound Name | 1-chloro-3-[(2E)-4-methylpenta-2,4-dien-2-yl]benzene |
|---|---|
| PubChem CID | 143764224 |
| Molecular Formula | C12H13Cl |
| Molecular Weight | 192.69 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 1-chloro-3-[(2E)-4-methylpenta-2,4-dien-2-yl]benzene |
| SMILES | C=C(C)/C=C(\C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H13Cl/c1-9(2)7-10(3)11-5-4-6-12(13)8-11/h4-8H,1H2,2-3H3/b10-7+ |
| InChIKey | COWVSXZFBTUVGA-JXMROGBWSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.69 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|