C10H9ClF3N — CID 115041180
(E)-3-(3-chlorophenyl)-4,4,4-trifluorobut-2-en-1-amine (PubChem CID 115041180) has the molecular formula C10H9ClF3N and a molecular weight of 235.64 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-4,4,4-trifluorobut-2-en-1-amine.
| Compound Name | (E)-3-(3-chlorophenyl)-4,4,4-trifluorobut-2-en-1-amine |
|---|---|
| PubChem CID | 115041180 |
| Molecular Formula | C10H9ClF3N |
| Molecular Weight | 235.64 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-4,4,4-trifluorobut-2-en-1-amine |
| SMILES | NC/C=C(\c1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C10H9ClF3N/c11-8-3-1-2-7(6-8)9(4-5-15)10(12,13)14/h1-4,6H,5,15H2/b9-4+ |
| InChIKey | NAWJMEMTOJQCDS-RUDMXATFSA-N |
| XLogP | 3.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |