C13H18ClN — CID 115034283
(Z)-3-(4-chlorophenyl)-4,4-dimethylpent-2-en-1-amine (PubChem CID 115034283) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is (Z)-3-(4-chlorophenyl)-4,4-dimethylpent-2-en-1-amine.
| Compound Name | (Z)-3-(4-chlorophenyl)-4,4-dimethylpent-2-en-1-amine |
|---|---|
| PubChem CID | 115034283 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (Z)-3-(4-chlorophenyl)-4,4-dimethylpent-2-en-1-amine |
| SMILES | CC(C)(C)/C(=C/CN)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18ClN/c1-13(2,3)12(8-9-15)10-4-6-11(14)7-5-10/h4-8H,9,15H2,1-3H3/b12-8+ |
| InChIKey | AGYJVOYWIUJWCV-XYOKQWHBSA-N |
| XLogP | 3.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |