C12H18ClNO — CID 79128366
4-amino-2-(4-chlorophenyl)-3,3-dimethylbutan-2-ol (PubChem CID 79128366) has the molecular formula C12H18ClNO and a molecular weight of 227.74 g/mol. Its IUPAC name is 4-amino-2-(4-chlorophenyl)-3,3-dimethylbutan-2-ol.
| Compound Name | 4-amino-2-(4-chlorophenyl)-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 79128366 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-amino-2-(4-chlorophenyl)-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(CN)C(C)(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H18ClNO/c1-11(2,8-14)12(3,15)9-4-6-10(13)7-5-9/h4-7,15H,8,14H2,1-3H3 |
| InChIKey | ZVJFVRFXZOXAIM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |