C11H13ClF2Si — CID 16745205
[1-(3-chlorophenyl)-2,2-difluoroethenyl]-trimethylsilane (PubChem CID 16745205) has the molecular formula C11H13ClF2Si and a molecular weight of 246.76 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-2,2-difluoroethenyl]-trimethylsilane.
| Compound Name | [1-(3-chlorophenyl)-2,2-difluoroethenyl]-trimethylsilane |
|---|---|
| PubChem CID | 16745205 |
| Molecular Formula | C11H13ClF2Si |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | [1-(3-chlorophenyl)-2,2-difluoroethenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C(=C(F)F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H13ClF2Si/c1-15(2,3)10(11(13)14)8-5-4-6-9(12)7-8/h4-7H,1-3H3 |
| InChIKey | PRXKZWQPROEHMT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|