C12H17NO5S — CID 134289360
(2,2,8-trimethyl-4H-1,3-benzodioxin-4-yl)methyl sulfamate (PubChem CID 134289360) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is (2,2,8-trimethyl-4H-1,3-benzodioxin-4-yl)methyl sulfamate.
| Compound Name | (2,2,8-trimethyl-4H-1,3-benzodioxin-4-yl)methyl sulfamate |
|---|---|
| PubChem CID | 134289360 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (2,2,8-trimethyl-4H-1,3-benzodioxin-4-yl)methyl sulfamate |
| SMILES | Cc1cccc2c1OC(C)(C)OC2COS(N)(=O)=O |
| InChI | InChI=1S/C12H17NO5S/c1-8-5-4-6-9-10(7-16-19(13,14)15)17-12(2,3)18-11(8)9/h4-6,10H,7H2,1-3H3,(H2,13,14,15) |
| InChIKey | NEZMVODYOPWNRP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |