C16H20O5 — CID 23468902
3-(2,3,7-trimethyl-3H-1-benzofuran-2-yl)pentanedioic acid (PubChem CID 23468902) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is 3-(2,3,7-trimethyl-3H-1-benzofuran-2-yl)pentanedioic acid.
| Compound Name | 3-(2,3,7-trimethyl-3H-1-benzofuran-2-yl)pentanedioic acid |
|---|---|
| PubChem CID | 23468902 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-(2,3,7-trimethyl-3H-1-benzofuran-2-yl)pentanedioic acid |
| SMILES | Cc1cccc2c1OC(C)(C(CC(=O)O)CC(=O)O)C2C |
| InChI | InChI=1S/C16H20O5/c1-9-5-4-6-12-10(2)16(3,21-15(9)12)11(7-13(17)18)8-14(19)20/h4-6,10-11H,7-8H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | VVSDNSINLXBYRN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |