C26H30O8S — CID 134279644
bis(spiro[4H-1,3-benzodioxine-2,1'-cyclopentane]-4-ylmethyl) sulfate (PubChem CID 134279644) has the molecular formula C26H30O8S and a molecular weight of 502.59 g/mol. Its IUPAC name is bis(spiro[4H-1,3-benzodioxine-2,1'-cyclopentane]-4-ylmethyl) sulfate.
| Compound Name | bis(spiro[4H-1,3-benzodioxine-2,1'-cyclopentane]-4-ylmethyl) sulfate |
|---|---|
| PubChem CID | 134279644 |
| Molecular Formula | C26H30O8S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | bis(spiro[4H-1,3-benzodioxine-2,1'-cyclopentane]-4-ylmethyl) sulfate |
| SMILES | O=S(=O)(OCC1OC2(CCCC2)Oc2ccccc21)OCC1OC2(CCCC2)Oc2ccccc21 |
| InChI | InChI=1S/C26H30O8S/c27-35(28,29-17-23-19-9-1-3-11-21(19)31-25(33-23)13-5-6-14-25)30-18-24-20-10-2-4-12-22(20)32-26(34-24)15-7-8-16-26/h1-4,9-12,23-24H,5-8,13-18H2 |
| InChIKey | BKOTXWKVNMWEQT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |