C13H16O5S — CID 134279625
[(4S)-spiro[4H-1,3-benzodioxine-2,1'-cyclopentane]-4-yl]methyl hydrogen sulfite (PubChem CID 134279625) has the molecular formula C13H16O5S and a molecular weight of 284.33 g/mol. Its IUPAC name is [(4S)-spiro[4H-1,3-benzodioxine-2,1'-cyclopentane]-4-yl]methyl hydrogen sulfite.
| Compound Name | [(4S)-spiro[4H-1,3-benzodioxine-2,1'-cyclopentane]-4-yl]methyl hydrogen sulfite |
|---|---|
| PubChem CID | 134279625 |
| Molecular Formula | C13H16O5S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | [(4S)-spiro[4H-1,3-benzodioxine-2,1'-cyclopentane]-4-yl]methyl hydrogen sulfite |
| SMILES | O=S(O)OC[C@H]1OC2(CCCC2)Oc2ccccc21 |
| InChI | InChI=1S/C13H16O5S/c14-19(15)16-9-12-10-5-1-2-6-11(10)17-13(18-12)7-3-4-8-13/h1-2,5-6,12H,3-4,7-9H2,(H,14,15)/t12-/m1/s1 |
| InChIKey | PDDDMQWOJNYQFL-GFCCVEGCSA-N |
| XLogP | 2.56 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|