C17H22O3 — CID 147558547
(2Z)-2-[(2R)-2-benzyl-1,4-dioxaspiro[4.5]decan-3-ylidene]ethanol (PubChem CID 147558547) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (2Z)-2-[(2R)-2-benzyl-1,4-dioxaspiro[4.5]decan-3-ylidene]ethanol.
| Compound Name | (2Z)-2-[(2R)-2-benzyl-1,4-dioxaspiro[4.5]decan-3-ylidene]ethanol |
|---|---|
| PubChem CID | 147558547 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (2Z)-2-[(2R)-2-benzyl-1,4-dioxaspiro[4.5]decan-3-ylidene]ethanol |
| SMILES | OC/C=C1\OC2(CCCCC2)O[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C17H22O3/c18-12-9-15-16(13-14-7-3-1-4-8-14)20-17(19-15)10-5-2-6-11-17/h1,3-4,7-9,16,18H,2,5-6,10-13H2/b15-9-/t16-/m1/s1 |
| InChIKey | FSDZSXKWRZURFP-QOBZYLRHSA-N |
| XLogP | 3.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |