C14H15FO3 — CID 117060691
2-[(4-fluorophenyl)methyl]-1,4-dioxaspiro[4.4]nonan-3-one (PubChem CID 117060691) has the molecular formula C14H15FO3 and a molecular weight of 250.27 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-1,4-dioxaspiro[4.4]nonan-3-one.
| Compound Name | 2-[(4-fluorophenyl)methyl]-1,4-dioxaspiro[4.4]nonan-3-one |
|---|---|
| PubChem CID | 117060691 |
| Molecular Formula | C14H15FO3 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-1,4-dioxaspiro[4.4]nonan-3-one |
| SMILES | O=C1OC2(CCCC2)OC1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H15FO3/c15-11-5-3-10(4-6-11)9-12-13(16)18-14(17-12)7-1-2-8-14/h3-6,12H,1-2,7-9H2 |
| InChIKey | PGNQKZOQNCZXKQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |