C19H26O4 — CID 163289119
1-(2-ethenyl-1,4-dioxaspiro[4.5]decan-3-yl)-2-phenylmethoxyethanol (PubChem CID 163289119) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 1-(2-ethenyl-1,4-dioxaspiro[4.5]decan-3-yl)-2-phenylmethoxyethanol.
| Compound Name | 1-(2-ethenyl-1,4-dioxaspiro[4.5]decan-3-yl)-2-phenylmethoxyethanol |
|---|---|
| PubChem CID | 163289119 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 1-(2-ethenyl-1,4-dioxaspiro[4.5]decan-3-yl)-2-phenylmethoxyethanol |
| SMILES | C=CC1OC2(CCCCC2)OC1C(O)COCc1ccccc1 |
| InChI | InChI=1S/C19H26O4/c1-2-17-18(23-19(22-17)11-7-4-8-12-19)16(20)14-21-13-15-9-5-3-6-10-15/h2-3,5-6,9-10,16-18,20H,1,4,7-8,11-14H2 |
| InChIKey | HGMLWMOXJYGRTB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|