C20H28O3 — CID 71477674
(3S)-3-[(2R)-1-phenylmethoxypent-4-en-2-yl]-1,4-dioxaspiro[4.5]decane (PubChem CID 71477674) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (3S)-3-[(2R)-1-phenylmethoxypent-4-en-2-yl]-1,4-dioxaspiro[4.5]decane.
| Compound Name | (3S)-3-[(2R)-1-phenylmethoxypent-4-en-2-yl]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 71477674 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (3S)-3-[(2R)-1-phenylmethoxypent-4-en-2-yl]-1,4-dioxaspiro[4.5]decane |
| SMILES | C=CC[C@H](COCc1ccccc1)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C20H28O3/c1-2-9-18(15-21-14-17-10-5-3-6-11-17)19-16-22-20(23-19)12-7-4-8-13-20/h2-3,5-6,10-11,18-19H,1,4,7-9,12-16H2/t18-,19-/m1/s1 |
| InChIKey | BMMGUPPZJFNKCA-RTBURBONSA-N |
| XLogP | 4.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|