C20H28O4 — CID 101106620
(E,1S,2S)-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2-phenylmethoxypent-3-en-1-ol (PubChem CID 101106620) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (E,1S,2S)-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2-phenylmethoxypent-3-en-1-ol.
| Compound Name | (E,1S,2S)-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2-phenylmethoxypent-3-en-1-ol |
|---|---|
| PubChem CID | 101106620 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (E,1S,2S)-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2-phenylmethoxypent-3-en-1-ol |
| SMILES | C/C=C/[C@H](OCc1ccccc1)[C@H](O)[C@@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C20H28O4/c1-2-9-17(22-14-16-10-5-3-6-11-16)19(21)18-15-23-20(24-18)12-7-4-8-13-20/h2-3,5-6,9-11,17-19,21H,4,7-8,12-15H2,1H3/b9-2+/t17-,18-,19-/m0/s1 |
| InChIKey | DNKZLZGDFAMDCS-RGGSMHMRSA-N |
| XLogP | 3.58 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|