C18H20O4 — CID 123770104
methoxy-[5-(2-methylphenyl)-2-phenyl-1,3-dioxolan-4-yl]methanol (PubChem CID 123770104) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is methoxy-[5-(2-methylphenyl)-2-phenyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | methoxy-[5-(2-methylphenyl)-2-phenyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 123770104 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | methoxy-[5-(2-methylphenyl)-2-phenyl-1,3-dioxolan-4-yl]methanol |
| SMILES | COC(O)C1OC(c2ccccc2)OC1c1ccccc1C |
| InChI | InChI=1S/C18H20O4/c1-12-8-6-7-11-14(12)15-16(17(19)20-2)22-18(21-15)13-9-4-3-5-10-13/h3-11,15-19H,1-2H3 |
| InChIKey | HTJRCGNGPKDDLC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|