C27H39N2O2PSi2 — CID 10255788
[[(2S,4S,5R)-3,4-dimethyl-2-[(S)-naphthalen-2-yl(trimethylsilyloxy)methyl]-5-phenyl-1,3,2lambda5-oxazaphospholidin-2-ylidene]amino]-trimethylsilane (PubChem CID 10255788) has the molecular formula C27H39N2O2PSi2 and a molecular weight of 510.77 g/mol. Its IUPAC name is [[(2S,4S,5R)-3,4-dimethyl-2-[(S)-naphthalen-2-yl(trimethylsilyloxy)methyl]-5-phenyl-1,3,2lambda5-oxazaphospholidin-2-ylidene]amino]-trimethylsilane.
| Compound Name | [[(2S,4S,5R)-3,4-dimethyl-2-[(S)-naphthalen-2-yl(trimethylsilyloxy)methyl]-5-phenyl-1,3,2lambda5-oxazaphospholidin-2-ylidene]amino]-trimethylsilane |
|---|---|
| PubChem CID | 10255788 |
| Molecular Formula | C27H39N2O2PSi2 |
| Molecular Weight | 510.77 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | [[(2S,4S,5R)-3,4-dimethyl-2-[(S)-naphthalen-2-yl(trimethylsilyloxy)methyl]-5-phenyl-1,3,2lambda5-oxazaphospholidin-2-ylidene]amino]-trimethylsilane |
| SMILES | C[C@H]1[C@@H](c2ccccc2)O[P@@](=N[Si](C)(C)C)([C@H](O[Si](C)(C)C)c2ccc3ccccc3c2)N1C |
| InChI | InChI=1S/C27H39N2O2PSi2/c1-21-26(23-15-10-9-11-16-23)30-32(29(21)2,28-33(3,4)5)27(31-34(6,7)8)25-19-18-22-14-12-13-17-24(22)20-25/h9-21,26-27H,1-8H3/t21-,26-,27-,32+/m0/s1 |
| InChIKey | GXBGLRFFZBWUNF-OYJHBXMHSA-N |
| XLogP | 8.65 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.77 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|