C24H39N2O2PSi2 — CID 10367657
[[(2S,4S,5R)-3,4-dimethyl-2-[(R)-(4-methylphenyl)-trimethylsilyloxymethyl]-5-phenyl-1,3,2λ5-oxazaphospholidin-2-ylidene]amino]-trimethylsilane (PubChem CID 10367657) has the molecular formula C24H39N2O2PSi2 and a molecular weight of 474.73 g/mol. Its IUPAC name is [[(2S,4S,5R)-3,4-dimethyl-2-[(R)-(4-methylphenyl)-trimethylsilyloxymethyl]-5-phenyl-1,3,2λ5-oxazaphospholidin-2-ylidene]amino]-trimethylsilane.
| Compound Name | [[(2S,4S,5R)-3,4-dimethyl-2-[(R)-(4-methylphenyl)-trimethylsilyloxymethyl]-5-phenyl-1,3,2λ5-oxazaphospholidin-2-ylidene]amino]-trimethylsilane |
|---|---|
| PubChem CID | 10367657 |
| Molecular Formula | C24H39N2O2PSi2 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | [[(2S,4S,5R)-3,4-dimethyl-2-[(R)-(4-methylphenyl)-trimethylsilyloxymethyl]-5-phenyl-1,3,2λ5-oxazaphospholidin-2-ylidene]amino]-trimethylsilane |
| SMILES | Cc1ccc([C@H](O[Si](C)(C)C)[P@]2(=N[Si](C)(C)C)O[C@H](c3ccccc3)[C@H](C)N2C)cc1 |
| InChI | InChI=1S/C24H39N2O2PSi2/c1-19-15-17-22(18-16-19)24(28-31(7,8)9)29(25-30(4,5)6)26(3)20(2)23(27-29)21-13-11-10-12-14-21/h10-18,20,23-24H,1-9H3/t20-,23-,24+,29+/m0/s1 |
| InChIKey | NTRVIBLCMJHUSQ-HTZDSBNASA-N |
| XLogP | 7.80 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|