C23H36N3O4PSi2 — CID 23314916
[[(4S,5R)-3,4-dimethyl-2-[(R)-(2-nitrophenyl)-trimethylsilyloxymethyl]-5-phenyl-1,3,2λ5-oxazaphospholidin-2-ylidene]amino]-trimethylsilane (PubChem CID 23314916) has the molecular formula C23H36N3O4PSi2 and a molecular weight of 505.70 g/mol. Its IUPAC name is [[(4S,5R)-3,4-dimethyl-2-[(R)-(2-nitrophenyl)-trimethylsilyloxymethyl]-5-phenyl-1,3,2λ5-oxazaphospholidin-2-ylidene]amino]-trimethylsilane.
| Compound Name | [[(4S,5R)-3,4-dimethyl-2-[(R)-(2-nitrophenyl)-trimethylsilyloxymethyl]-5-phenyl-1,3,2λ5-oxazaphospholidin-2-ylidene]amino]-trimethylsilane |
|---|---|
| PubChem CID | 23314916 |
| Molecular Formula | C23H36N3O4PSi2 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | [[(4S,5R)-3,4-dimethyl-2-[(R)-(2-nitrophenyl)-trimethylsilyloxymethyl]-5-phenyl-1,3,2λ5-oxazaphospholidin-2-ylidene]amino]-trimethylsilane |
| SMILES | C[C@H]1[C@@H](c2ccccc2)OP(=N[Si](C)(C)C)([C@@H](O[Si](C)(C)C)c2ccccc2[N+](=O)[O-])N1C |
| InChI | InChI=1S/C23H36N3O4PSi2/c1-18-22(19-14-10-9-11-15-19)29-31(25(18)2,24-32(3,4)5)23(30-33(6,7)8)20-16-12-13-17-21(20)26(27)28/h9-18,22-23H,1-8H3/t18-,22-,23+,31?/m0/s1 |
| InChIKey | YMIVDEWYQBSBFF-QSBRZZCBSA-N |
| XLogP | 7.40 |
| TPSA | 77.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|