C18H20NO6P — CID 102180508
[(4S)-5,5-dimethyl-2-oxido-4-phenyl-1,3,2-dioxaphosphinan-2-ium-2-yl]-(2-nitrophenyl)methanol (PubChem CID 102180508) has the molecular formula C18H20NO6P and a molecular weight of 377.33 g/mol. Its IUPAC name is [(4S)-5,5-dimethyl-2-oxido-4-phenyl-1,3,2-dioxaphosphinan-2-ium-2-yl]-(2-nitrophenyl)methanol.
| Compound Name | [(4S)-5,5-dimethyl-2-oxido-4-phenyl-1,3,2-dioxaphosphinan-2-ium-2-yl]-(2-nitrophenyl)methanol |
|---|---|
| PubChem CID | 102180508 |
| Molecular Formula | C18H20NO6P |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | [(4S)-5,5-dimethyl-2-oxido-4-phenyl-1,3,2-dioxaphosphinan-2-ium-2-yl]-(2-nitrophenyl)methanol |
| SMILES | CC1(C)CO[P+]([O-])(C(O)c2ccccc2[N+](=O)[O-])O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H20NO6P/c1-18(2)12-24-26(23,25-16(18)13-8-4-3-5-9-13)17(20)14-10-6-7-11-15(14)19(21)22/h3-11,16-17,20H,12H2,1-2H3/t16-,17?,26?/m0/s1 |
| InChIKey | MGGPVIJVFKEHGQ-VZMMAYBGSA-N |
| XLogP | 3.52 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|