C15H10Br2N2O5 — CID 101219469
1,3-dibromo-1,3-bis(2-nitrophenyl)propan-2-one (PubChem CID 101219469) has the molecular formula C15H10Br2N2O5 and a molecular weight of 458.06 g/mol. Its IUPAC name is 1,3-dibromo-1,3-bis(2-nitrophenyl)propan-2-one.
| Compound Name | 1,3-dibromo-1,3-bis(2-nitrophenyl)propan-2-one |
|---|---|
| PubChem CID | 101219469 |
| Molecular Formula | C15H10Br2N2O5 |
| Molecular Weight | 458.06 g/mol |
| Exact Mass | 455.90 |
| IUPAC Name | 1,3-dibromo-1,3-bis(2-nitrophenyl)propan-2-one |
| SMILES | O=C(C(Br)c1ccccc1[N+](=O)[O-])C(Br)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H10Br2N2O5/c16-13(9-5-1-3-7-11(9)18(21)22)15(20)14(17)10-6-2-4-8-12(10)19(23)24/h1-8,13-14H |
| InChIKey | VYXCEZZMKSLREZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.06 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|