About 1-[1,2-dibromo-2-(2-chlorophenyl)ethyl]-2-nitrobenzene
1-[1,2-dibromo-2-(2-chlorophenyl)ethyl]-2-nitrobenzene (PubChem CID 19937623) has the molecular formula C14H10Br2ClNO2
and a molecular weight of 419.50 g/mol. Its IUPAC name is 1-[1,2-dibromo-2-(2-chlorophenyl)ethyl]-2-nitrobenzene.
Molecular Properties
| Compound Name | 1-[1,2-dibromo-2-(2-chlorophenyl)ethyl]-2-nitrobenzene |
| PubChem CID | 19937623 |
| Molecular Formula | C14H10Br2ClNO2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 416.88 |
| IUPAC Name | 1-[1,2-dibromo-2-(2-chlorophenyl)ethyl]-2-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccccc1C(Br)C(Br)c1ccccc1Cl |
| InChI | InChI=1S/C14H10Br2ClNO2/c15-13(9-5-1-3-7-11(9)17)14(16)10-6-2-4-8-12(10)18(19)20/h1-8,13-14H |
| InChIKey | GAKVIGUYWGMKPK-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[1,2-dibromo-2-(2-chlorophenyl)ethyl]-2-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,2-dibromo-2-(2-chlorophenyl)ethyl]-2-nitrobenzene?
The IUPAC name of 1-[1,2-dibromo-2-(2-chlorophenyl)ethyl]-2-nitrobenzene (CID 19937623) is 1-[1,2-dibromo-2-(2-chlorophenyl)ethyl]-2-nitrobenzene.
What is the SMILES notation for 1-[1,2-dibromo-2-(2-chlorophenyl)ethyl]-2-nitrobenzene?
The canonical SMILES for 1-[1,2-dibromo-2-(2-chlorophenyl)ethyl]-2-nitrobenzene is O=[N+]([O-])c1ccccc1C(Br)C(Br)c1ccccc1Cl.
What is the InChIKey of 1-[1,2-dibromo-2-(2-chlorophenyl)ethyl]-2-nitrobenzene?
The InChIKey is GAKVIGUYWGMKPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Br2ClNO2/c15-13(9-5-1-3-7-11(9)17)14(16)10-6-2-4-8-12(10)18(19)20/h1-8,13-14H.
What are the key properties of 1-[1,2-dibromo-2-(2-chlorophenyl)ethyl]-2-nitrobenzene?
1-[1,2-dibromo-2-(2-chlorophenyl)ethyl]-2-nitrobenzene has a molecular weight of 419.50 g/mol, XLogP of 5.82, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,2-dibromo-2-(2-chlorophenyl)ethyl]-2-nitrobenzene is sourced from PubChem (CID 19937623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).