C17H14Br2N2O5 — CID 152545719
1,5-dibromo-2,4-bis(2-nitrophenyl)pentan-3-one (PubChem CID 152545719) has the molecular formula C17H14Br2N2O5 and a molecular weight of 486.12 g/mol. Its IUPAC name is 1,5-dibromo-2,4-bis(2-nitrophenyl)pentan-3-one.
| Compound Name | 1,5-dibromo-2,4-bis(2-nitrophenyl)pentan-3-one |
|---|---|
| PubChem CID | 152545719 |
| Molecular Formula | C17H14Br2N2O5 |
| Molecular Weight | 486.12 g/mol |
| Exact Mass | 483.93 |
| IUPAC Name | 1,5-dibromo-2,4-bis(2-nitrophenyl)pentan-3-one |
| SMILES | O=C(C(CBr)c1ccccc1[N+](=O)[O-])C(CBr)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14Br2N2O5/c18-9-13(11-5-1-3-7-15(11)20(23)24)17(22)14(10-19)12-6-2-4-8-16(12)21(25)26/h1-8,13-14H,9-10H2 |
| InChIKey | YMLGOSARTIPZEP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.12 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|