C17H34N3OPSi2 — CID 10971020
[[1,3-dimethyl-2-[phenyl(trimethylsilyloxy)methyl]-1,3,2lambda5-diazaphospholidin-2-ylidene]amino]-trimethylsilane (PubChem CID 10971020) has the molecular formula C17H34N3OPSi2 and a molecular weight of 383.63 g/mol. Its IUPAC name is [[1,3-dimethyl-2-[phenyl(trimethylsilyloxy)methyl]-1,3,2lambda5-diazaphospholidin-2-ylidene]amino]-trimethylsilane.
| Compound Name | [[1,3-dimethyl-2-[phenyl(trimethylsilyloxy)methyl]-1,3,2lambda5-diazaphospholidin-2-ylidene]amino]-trimethylsilane |
|---|---|
| PubChem CID | 10971020 |
| Molecular Formula | C17H34N3OPSi2 |
| Molecular Weight | 383.63 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | [[1,3-dimethyl-2-[phenyl(trimethylsilyloxy)methyl]-1,3,2lambda5-diazaphospholidin-2-ylidene]amino]-trimethylsilane |
| SMILES | CN1CCN(C)P1(=N[Si](C)(C)C)C(O[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H34N3OPSi2/c1-19-14-15-20(2)22(19,18-23(3,4)5)17(21-24(6,7)8)16-12-10-9-11-13-16/h9-13,17H,14-15H2,1-8H3 |
| InChIKey | SWDIDDZYEPMXND-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.63 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|