C16H27NOSi — CID 173191032
N,N-diethyl-3-phenyl-3-trimethylsilyloxyprop-1-en-1-amine (PubChem CID 173191032) has the molecular formula C16H27NOSi and a molecular weight of 277.48 g/mol. Its IUPAC name is N,N-diethyl-3-phenyl-3-trimethylsilyloxyprop-1-en-1-amine.
| Compound Name | N,N-diethyl-3-phenyl-3-trimethylsilyloxyprop-1-en-1-amine |
|---|---|
| PubChem CID | 173191032 |
| Molecular Formula | C16H27NOSi |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | N,N-diethyl-3-phenyl-3-trimethylsilyloxyprop-1-en-1-amine |
| SMILES | CCN(C=CC(O[Si](C)(C)C)c1ccccc1)CC |
| InChI | InChI=1S/C16H27NOSi/c1-6-17(7-2)14-13-16(18-19(3,4)5)15-11-9-8-10-12-15/h8-14,16H,6-7H2,1-5H3 |
| InChIKey | DTRPANVYAAVLKT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|