C24H26OSiTe — CID 102462784
[(E)-1,3-diphenyl-3-phenyltellanylprop-2-enoxy]-trimethylsilane (PubChem CID 102462784) has the molecular formula C24H26OSiTe and a molecular weight of 486.16 g/mol. Its IUPAC name is [(E)-1,3-diphenyl-3-phenyltellanylprop-2-enoxy]-trimethylsilane.
| Compound Name | [(E)-1,3-diphenyl-3-phenyltellanylprop-2-enoxy]-trimethylsilane |
|---|---|
| PubChem CID | 102462784 |
| Molecular Formula | C24H26OSiTe |
| Molecular Weight | 486.16 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | [(E)-1,3-diphenyl-3-phenyltellanylprop-2-enoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)OC(/C=C(/[Te]c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26OSiTe/c1-26(2,3)25-23(20-13-7-4-8-14-20)19-24(21-15-9-5-10-16-21)27-22-17-11-6-12-18-22/h4-19,23H,1-3H3/b24-19+ |
| InChIKey | PDHIDBYPNPSKFR-LYBHJNIJSA-N |
| XLogP | 5.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.16 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|