C17H17NOTe — CID 101134069
(E)-N,N-dimethyl-3-phenyl-3-phenyltellanylprop-2-enamide (PubChem CID 101134069) has the molecular formula C17H17NOTe and a molecular weight of 378.93 g/mol. Its IUPAC name is (E)-N,N-dimethyl-3-phenyl-3-phenyltellanylprop-2-enamide.
| Compound Name | (E)-N,N-dimethyl-3-phenyl-3-phenyltellanylprop-2-enamide |
|---|---|
| PubChem CID | 101134069 |
| Molecular Formula | C17H17NOTe |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | (E)-N,N-dimethyl-3-phenyl-3-phenyltellanylprop-2-enamide |
| SMILES | CN(C)C(=O)/C=C(/[Te]c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17NOTe/c1-18(2)17(19)13-16(14-9-5-3-6-10-14)20-15-11-7-4-8-12-15/h3-13H,1-2H3/b16-13+ |
| InChIKey | QUYRKAGZHWQFGM-DTQAZKPQSA-N |
| XLogP | 2.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|